C21H28N4 — CID 119108088
(E)-2-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-phenylprop-2-en-1-amine (PubChem CID 119108088) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is (E)-2-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-phenylprop-2-en-1-amine.
| Compound Name | (E)-2-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 119108088 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (E)-2-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-phenylprop-2-en-1-amine |
| SMILES | C/C(=C\c1ccccc1)CNCc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C21H28N4/c1-18(14-19-6-4-3-5-7-19)16-22-17-20-8-9-23-21(15-20)25-12-10-24(2)11-13-25/h3-9,14-15,22H,10-13,16-17H2,1-2H3/b18-14+ |
| InChIKey | KROGATUBGOBECU-NBVRZTHBSA-N |
| XLogP | 3.03 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |