C18H21N3O — CID 119109208
3-(1-methylpyrazol-4-yl)-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine (PubChem CID 119109208) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine.
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 119109208 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine |
| SMILES | Cn1cc(CCCNCc2ccc(-c3ccccc3)o2)cn1 |
| InChI | InChI=1S/C18H21N3O/c1-21-14-15(12-20-21)6-5-11-19-13-17-9-10-18(22-17)16-7-3-2-4-8-16/h2-4,7-10,12,14,19H,5-6,11,13H2,1H3 |
| InChIKey | WRGHDLYDQLOYSK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|