C14H19ClN4S — CID 119116065
1-tert-butyl-3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methylguanidine (PubChem CID 119116065) has the molecular formula C14H19ClN4S and a molecular weight of 310.85 g/mol. Its IUPAC name is 1-tert-butyl-3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-tert-butyl-3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 119116065 |
| Molecular Formula | C14H19ClN4S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-tert-butyl-3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1nc2cc(Cl)ccc2s1)NC(C)(C)C |
| InChI | InChI=1S/C14H19ClN4S/c1-14(2,3)19-13(16-4)17-8-12-18-10-7-9(15)5-6-11(10)20-12/h5-7H,8H2,1-4H3,(H2,16,17,19) |
| InChIKey | ZILWUVONRARMMR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|