C16H19ClIN5S2 — CID 119116913
2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-1-ethyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 119116913) has the molecular formula C16H19ClIN5S2 and a molecular weight of 507.85 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-1-ethyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-1-ethyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119116913 |
| Molecular Formula | C16H19ClIN5S2 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-1-ethyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc2cc(Cl)ccc2s1)NCc1nc(C)cs1.I |
| InChI | InChI=1S/C16H18ClN5S2.HI/c1-3-18-16(19-7-14-21-10(2)9-23-14)20-8-15-22-12-6-11(17)4-5-13(12)24-15;/h4-6,9H,3,7-8H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | JRHDOIVTKHQMDX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|