C15H17ClN6S — CID 119151683
1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 119151683) has the molecular formula C15H17ClN6S and a molecular weight of 348.86 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119151683 |
| Molecular Formula | C15H17ClN6S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1nc2cc(Cl)ccc2s1)NCc1ccnn1C |
| InChI | InChI=1S/C15H17ClN6S/c1-17-15(18-8-11-5-6-20-22(11)2)19-9-14-21-12-7-10(16)3-4-13(12)23-14/h3-7H,8-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | WVTKXGKYJSEULE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|