C16H20ClIN6S — CID 119151672
1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 119151672) has the molecular formula C16H20ClIN6S and a molecular weight of 490.80 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151672 |
| Molecular Formula | C16H20ClIN6S |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCc1nc2cc(Cl)ccc2s1.I |
| InChI | InChI=1S/C16H19ClN6S.HI/c1-3-18-16(19-9-12-6-7-21-23(12)2)20-10-15-22-13-8-11(17)4-5-14(13)24-15;/h4-8H,3,9-10H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | JIHZDKUESFLYQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|