C15H20N4O2 — CID 119117447
N'-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]morpholine-4-carboximidamide (PubChem CID 119117447) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N'-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]morpholine-4-carboximidamide.
| Compound Name | N'-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 119117447 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N'-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\CCC1C(=O)Nc2ccccc21)N1CCOCC1 |
| InChI | InChI=1S/C15H20N4O2/c16-15(19-7-9-21-10-8-19)17-6-5-12-11-3-1-2-4-13(11)18-14(12)20/h1-4,12H,5-10H2,(H2,16,17)(H,18,20) |
| InChIKey | CESYCTPQBSRYCE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|