C11H19IN6 — CID 119119605
1-prop-2-enyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 119119605) has the molecular formula C11H19IN6 and a molecular weight of 362.22 g/mol. Its IUPAC name is 1-prop-2-enyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-prop-2-enyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119119605 |
| Molecular Formula | C11H19IN6 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 1-prop-2-enyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/Cc1nnc2n1CCCC2.I |
| InChI | InChI=1S/C11H18N6.HI/c1-2-6-13-11(12)14-8-10-16-15-9-5-3-4-7-17(9)10;/h2H,1,3-8H2,(H3,12,13,14);1H |
| InChIKey | XKMZYBMEWMJACQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|