C18H22ClN3O3S — CID 119141504
1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methylguanidine (PubChem CID 119141504) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methylguanidine.
| Compound Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119141504 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(Cl)c2c(c1)OCCO2)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-18(23,13-3-6-26-10-13)11-22-17(20-2)21-9-12-7-14(19)16-15(8-12)24-4-5-25-16/h3,6-8,10,23H,4-5,9,11H2,1-2H3,(H2,20,21,22) |
| InChIKey | ORPYIDXRBFPVST-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|