C18H33N5O — CID 119144054
N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119144054) has the molecular formula C18H33N5O and a molecular weight of 335.50 g/mol. Its IUPAC name is N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119144054 |
| Molecular Formula | C18H33N5O |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCC(C)N1CCN(C)CC1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C18H33N5O/c1-13(22-8-6-21(3)7-9-22)10-20-18(19-2)23-11-14-15(12-23)17-5-4-16(14)24-17/h13-17H,4-12H2,1-3H3,(H,19,20) |
| InChIKey | MSBQBTOPLYEQHT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|