C19H37IN4O — CID 119147169
N'-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 119147169) has the molecular formula C19H37IN4O and a molecular weight of 464.44 g/mol. Its IUPAC name is N'-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119147169 |
| Molecular Formula | C19H37IN4O |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N'-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | COC1CCN(C2(C/N=C(\N)N3CCCC(C)C3)CCCC2)CC1.I |
| InChI | InChI=1S/C19H36N4O.HI/c1-16-6-5-11-22(14-16)18(20)21-15-19(9-3-4-10-19)23-12-7-17(24-2)8-13-23;/h16-17H,3-15H2,1-2H3,(H2,20,21);1H |
| InChIKey | RYMOFEJRLVACIS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|