C10H16IN5 — CID 119149131
2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 119149131) has the molecular formula C10H16IN5 and a molecular weight of 333.18 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119149131 |
| Molecular Formula | C10H16IN5 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NCc1cn[nH]c1C.I |
| InChI | InChI=1S/C10H15N5.HI/c1-4-5-12-10(11-3)13-6-9-7-14-15-8(9)2;/h1,7H,5-6H2,2-3H3,(H,14,15)(H2,11,12,13);1H |
| InChIKey | QPCWVTJFPJPYLB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|