C15H19N5O2 — CID 119148864
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine (PubChem CID 119148864) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119148864 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCc1cn[nH]c1C |
| InChI | InChI=1S/C15H19N5O2/c1-10-12(8-19-20-10)7-18-15(16-2)17-6-11-3-4-13-14(5-11)22-9-21-13/h3-5,8H,6-7,9H2,1-2H3,(H,19,20)(H2,16,17,18) |
| InChIKey | QDXQKLYZJBVGMX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|