C17H22N4 — CID 119148946
2-methyl-1-prop-2-ynyl-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine (PubChem CID 119148946) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-methyl-1-prop-2-ynyl-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-prop-2-ynyl-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119148946 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-methyl-1-prop-2-ynyl-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine |
| SMILES | C#CCN/C(=N\C)NCc1cc(C)cc2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C17H22N4/c1-6-7-19-17(18-5)20-10-14-8-11(2)9-15-12(3)13(4)21-16(14)15/h1,8-9,21H,7,10H2,2-5H3,(H2,18,19,20) |
| InChIKey | CWHPXCYFRKIESQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|