C17H31F3IN3O — CID 119157295
1-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-methyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide (PubChem CID 119157295) has the molecular formula C17H31F3IN3O and a molecular weight of 477.35 g/mol. Its IUPAC name is 1-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-methyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-methyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119157295 |
| Molecular Formula | C17H31F3IN3O |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-methyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1(C)CCCCC1O)NC1CCC(C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H30F3N3O.HI/c1-16(10-4-3-5-14(16)24)11-22-15(21-2)23-13-8-6-12(7-9-13)17(18,19)20;/h12-14,24H,3-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | JDAWWACJEVTYCL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|