C19H27N7O2 — CID 119157851
4-(furan-2-carbonyl)-N'-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide (PubChem CID 119157851) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119157851 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCC1CCc2nnc(C)n2C1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H27N7O2/c1-14-22-23-17-6-5-15(13-26(14)17)12-21-19(20-2)25-9-7-24(8-10-25)18(27)16-4-3-11-28-16/h3-4,11,15H,5-10,12-13H2,1-2H3,(H,20,21) |
| InChIKey | UKINTYSAHWVVEV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|