C19H20BrNO — CID 1192016
2-bromo-N-(2,6-diethylphenyl)-3-phenylprop-2-enamide (PubChem CID 1192016) has the molecular formula C19H20BrNO and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-bromo-N-(2,6-diethylphenyl)-3-phenylprop-2-enamide.
| Compound Name | 2-bromo-N-(2,6-diethylphenyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 1192016 |
| Molecular Formula | C19H20BrNO |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-bromo-N-(2,6-diethylphenyl)-3-phenylprop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(Br)=Cc1ccccc1 |
| InChI | InChI=1S/C19H20BrNO/c1-3-15-11-8-12-16(4-2)18(15)21-19(22)17(20)13-14-9-6-5-7-10-14/h5-13H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | BZAUMUIFEDPOFG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|