C14H16Cl2N2O2 — CID 156785541
(Z)-2,3-dichloro-N'-(2,6-diethylphenyl)but-2-enediamide (PubChem CID 156785541) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is (Z)-2,3-dichloro-N'-(2,6-diethylphenyl)but-2-enediamide.
| Compound Name | (Z)-2,3-dichloro-N'-(2,6-diethylphenyl)but-2-enediamide |
|---|---|
| PubChem CID | 156785541 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (Z)-2,3-dichloro-N'-(2,6-diethylphenyl)but-2-enediamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C(Cl)=C(/Cl)C(N)=O |
| InChI | InChI=1S/C14H16Cl2N2O2/c1-3-8-6-5-7-9(4-2)12(8)18-14(20)11(16)10(15)13(17)19/h5-7H,3-4H2,1-2H3,(H2,17,19)(H,18,20)/b11-10- |
| InChIKey | ZTCBYFPBOGUXDD-KHPPLWFESA-N |
| XLogP | 2.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|