C16H17NO4S — CID 119210339
2-[4-(2H-chromene-3-carbonyl)thiomorpholin-3-yl]acetic acid (PubChem CID 119210339) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-[4-(2H-chromene-3-carbonyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2H-chromene-3-carbonyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210339 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[4-(2H-chromene-3-carbonyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C16H17NO4S/c18-15(19)8-13-10-22-6-5-17(13)16(20)12-7-11-3-1-2-4-14(11)21-9-12/h1-4,7,13H,5-6,8-10H2,(H,18,19) |
| InChIKey | ALZIKZZVXRECEG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |