C15H15ClN4O3S — CID 119210433
2-[4-[1-(2-chlorophenyl)triazole-4-carbonyl]thiomorpholin-3-yl]acetic acid (PubChem CID 119210433) has the molecular formula C15H15ClN4O3S and a molecular weight of 366.83 g/mol. Its IUPAC name is 2-[4-[1-(2-chlorophenyl)triazole-4-carbonyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[1-(2-chlorophenyl)triazole-4-carbonyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210433 |
| Molecular Formula | C15H15ClN4O3S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[4-[1-(2-chlorophenyl)triazole-4-carbonyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)c1cn(-c2ccccc2Cl)nn1 |
| InChI | InChI=1S/C15H15ClN4O3S/c16-11-3-1-2-4-13(11)20-8-12(17-18-20)15(23)19-5-6-24-9-10(19)7-14(21)22/h1-4,8,10H,5-7,9H2,(H,21,22) |
| InChIKey | LOIYRIWBHPTJHA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |