C15H18N4O4S — CID 119231009
2-[3-[[3-methyl-2-(thiophene-2-carbonylamino)butanoyl]amino]pyrazol-1-yl]acetic acid (PubChem CID 119231009) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[3-[[3-methyl-2-(thiophene-2-carbonylamino)butanoyl]amino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[[3-methyl-2-(thiophene-2-carbonylamino)butanoyl]amino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119231009 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[3-[[3-methyl-2-(thiophene-2-carbonylamino)butanoyl]amino]pyrazol-1-yl]acetic acid |
| SMILES | CC(C)C(NC(=O)c1cccs1)C(=O)Nc1ccn(CC(=O)O)n1 |
| InChI | InChI=1S/C15H18N4O4S/c1-9(2)13(17-14(22)10-4-3-7-24-10)15(23)16-11-5-6-19(18-11)8-12(20)21/h3-7,9,13H,8H2,1-2H3,(H,17,22)(H,20,21)(H,16,18,23) |
| InChIKey | XCZVMKXYQRULAS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |