C20H20N2O5S — CID 11925874
(5R)-5-benzyl-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-phenylimidazolidine-2,4-dione (PubChem CID 11925874) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11925874 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (5R)-5-benzyl-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@](Cc2ccccc2)(c2ccccc2)C(=O)N1[C@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C20H20N2O5S/c23-17-13-28(26,27)12-16(17)22-18(24)20(21-19(22)25,15-9-5-2-6-10-15)11-14-7-3-1-4-8-14/h1-10,16-17,23H,11-13H2,(H,21,25)/t16-,17-,20+/m0/s1 |
| InChIKey | FEZIREXIHDLWBX-ABSDTBQOSA-N |
| XLogP | 0.83 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|