C13H21ClN2O4 — CID 119293502
methyl 5-[(2-aminopentanoylamino)methyl]-2-methylfuran-3-carboxylate;hydrochloride (PubChem CID 119293502) has the molecular formula C13H21ClN2O4 and a molecular weight of 304.77 g/mol. Its IUPAC name is methyl 5-[(2-aminopentanoylamino)methyl]-2-methylfuran-3-carboxylate;hydrochloride.
| Compound Name | methyl 5-[(2-aminopentanoylamino)methyl]-2-methylfuran-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119293502 |
| Molecular Formula | C13H21ClN2O4 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 5-[(2-aminopentanoylamino)methyl]-2-methylfuran-3-carboxylate;hydrochloride |
| SMILES | CCCC(N)C(=O)NCc1cc(C(=O)OC)c(C)o1.Cl |
| InChI | InChI=1S/C13H20N2O4.ClH/c1-4-5-11(14)12(16)15-7-9-6-10(8(2)19-9)13(17)18-3;/h6,11H,4-5,7,14H2,1-3H3,(H,15,16);1H |
| InChIKey | RZGJEGUCHVUUQK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |