C18H24N2O6S — CID 119358030
4-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]morpholine-2-carboxylic acid (PubChem CID 119358030) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119358030 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]morpholine-2-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)N3CCOC(C(=O)O)C3)C2)cc1 |
| InChI | InChI=1S/C18H24N2O6S/c1-13-4-6-15(7-5-13)27(24,25)20-8-2-3-14(11-20)17(21)19-9-10-26-16(12-19)18(22)23/h4-7,14,16H,2-3,8-12H2,1H3,(H,22,23) |
| InChIKey | PHEPTWZJHFUYSK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |