C17H22BrClFN3O2 — CID 119403924
[1-(4-bromo-3-fluorobenzoyl)piperidin-2-yl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119403924) has the molecular formula C17H22BrClFN3O2 and a molecular weight of 434.74 g/mol. Its IUPAC name is [1-(4-bromo-3-fluorobenzoyl)piperidin-2-yl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [1-(4-bromo-3-fluorobenzoyl)piperidin-2-yl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119403924 |
| Molecular Formula | C17H22BrClFN3O2 |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | [1-(4-bromo-3-fluorobenzoyl)piperidin-2-yl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCCN1C(=O)c1ccc(Br)c(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C17H21BrFN3O2.ClH/c18-13-5-4-12(11-14(13)19)16(23)22-8-2-1-3-15(22)17(24)21-9-6-20-7-10-21;/h4-5,11,15,20H,1-3,6-10H2;1H |
| InChIKey | TVIDYIJXRCUFFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |