C18H21FN2O4 — CID 119421050
N-(2-amino-5-methoxyphenyl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide (PubChem CID 119421050) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide |
|---|---|
| PubChem CID | 119421050 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide |
| SMILES | COCCOCc1cc(C(=O)Nc2cc(OC)ccc2N)ccc1F |
| InChI | InChI=1S/C18H21FN2O4/c1-23-7-8-25-11-13-9-12(3-5-15(13)19)18(22)21-17-10-14(24-2)4-6-16(17)20/h3-6,9-10H,7-8,11,20H2,1-2H3,(H,21,22) |
| InChIKey | BHZNHQSQCPEDMR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|