C18H26FN4O3S+ — CID 11943585
2-[[(3aS,4R,5R,7R,7aR)-2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]amino]ethyl-dimethylazanium (PubChem CID 11943585) has the molecular formula C18H26FN4O3S+ and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[[(3aS,4R,5R,7R,7aR)-2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[(3aS,4R,5R,7R,7aR)-2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 11943585 |
| Molecular Formula | C18H26FN4O3S+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[[(3aS,4R,5R,7R,7aR)-2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3ccc(F)cc3)S[C@@H]21 |
| InChI | InChI=1S/C18H25FN4O3S/c1-23(2)8-7-20-17(26)12-9-13(24)15(25)14-16(12)27-18(22-14)21-11-5-3-10(19)4-6-11/h3-6,12-16,24-25H,7-9H2,1-2H3,(H,20,26)(H,21,22)/p+1/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | HJDCJKUYAKKSNG-XFIYOXNOSA-O |
| XLogP | -0.92 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |