C21H25F3N4O4S — CID 26744714
1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide (PubChem CID 26744714) has the molecular formula C21H25F3N4O4S and a molecular weight of 486.52 g/mol. Its IUPAC name is 1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26744714 |
| Molecular Formula | C21H25F3N4O4S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)[C@H]2C[C@@H](O)[C@H](O)[C@@H]3N=C(Nc4cccc(C(F)(F)F)c4)S[C@@H]32)CC1 |
| InChI | InChI=1S/C21H25F3N4O4S/c22-21(23,24)11-2-1-3-12(8-11)26-20-27-15-16(30)14(29)9-13(17(15)33-20)19(32)28-6-4-10(5-7-28)18(25)31/h1-3,8,10,13-17,29-30H,4-7,9H2,(H2,25,31)(H,26,27)/t13-,14+,15-,16-,17+/m0/s1 |
| InChIKey | XXRJMLDQZJIDNS-BQJWPVKWSA-N |
| XLogP | 1.42 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |