C18H22FN3O3S — CID 119465603
N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-fluorophenyl)-2-methylpropanamide (PubChem CID 119465603) has the molecular formula C18H22FN3O3S and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-fluorophenyl)-2-methylpropanamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-fluorophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 119465603 |
| Molecular Formula | C18H22FN3O3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-fluorophenyl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1cccc(S(=O)(=O)NCCN)c1)c1ccccc1F |
| InChI | InChI=1S/C18H22FN3O3S/c1-18(2,15-8-3-4-9-16(15)19)17(23)22-13-6-5-7-14(12-13)26(24,25)21-11-10-20/h3-9,12,21H,10-11,20H2,1-2H3,(H,22,23) |
| InChIKey | PQFHQLPTDHQTKW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |