C37H29BrN2O6 — CID 11946735
ethyl (2S,6R,8R,12R)-7-bromo-1,14-dimethyl-4,10-dinaphthalen-1-yl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 11946735) has the molecular formula C37H29BrN2O6 and a molecular weight of 677.55 g/mol. Its IUPAC name is ethyl (2S,6R,8R,12R)-7-bromo-1,14-dimethyl-4,10-dinaphthalen-1-yl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (2S,6R,8R,12R)-7-bromo-1,14-dimethyl-4,10-dinaphthalen-1-yl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 11946735 |
| Molecular Formula | C37H29BrN2O6 |
| Molecular Weight | 677.55 g/mol |
| Exact Mass | 676.12 |
| IUPAC Name | ethyl (2S,6R,8R,12R)-7-bromo-1,14-dimethyl-4,10-dinaphthalen-1-yl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C2(Br)[C@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@H]3C1(C)[C@H]1C(=O)N(c3cccc4ccccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C37H29BrN2O6/c1-4-46-35(45)26-19(2)37(38)29-27(31(41)39(33(29)43)24-17-9-13-20-11-5-7-15-22(20)24)36(26,3)28-30(37)34(44)40(32(28)42)25-18-10-14-21-12-6-8-16-23(21)25/h5-18,27-30H,4H2,1-3H3/t27-,28+,29-,30-,36?,37?/m1/s1 |
| InChIKey | KMQGLPQSDINIMG-GOQVTCJGSA-N |
| XLogP | 5.95 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|