C11H19N3O3S2 — CID 119569037
N-[3-(aminomethyl)pentan-3-yl]-5-sulfamoylthiophene-3-carboxamide (PubChem CID 119569037) has the molecular formula C11H19N3O3S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-5-sulfamoylthiophene-3-carboxamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-5-sulfamoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 119569037 |
| Molecular Formula | C11H19N3O3S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-5-sulfamoylthiophene-3-carboxamide |
| SMILES | CCC(CC)(CN)NC(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H19N3O3S2/c1-3-11(4-2,7-12)14-10(15)8-5-9(18-6-8)19(13,16)17/h5-6H,3-4,7,12H2,1-2H3,(H,14,15)(H2,13,16,17) |
| InChIKey | BPOMYWMKYAFPCM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |