C20H27NO5 — CID 11961806
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(S)-hydroxy-(3-nitrophenyl)methyl]prop-2-enoate (PubChem CID 11961806) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(S)-hydroxy-(3-nitrophenyl)methyl]prop-2-enoate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(S)-hydroxy-(3-nitrophenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11961806 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(S)-hydroxy-(3-nitrophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C)[C@@H](O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H27NO5/c1-12(2)17-9-8-13(3)10-18(17)26-20(23)14(4)19(22)15-6-5-7-16(11-15)21(24)25/h5-7,11-13,17-19,22H,4,8-10H2,1-3H3/t13-,17+,18-,19+/m0/s1 |
| InChIKey | UNSAVBPEYIOWKX-NUDXDXSLSA-N |
| XLogP | 4.19 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|