C18H22O2 — CID 11970087
[(1S,6S,7S)-7-[(E)-prop-1-enyl]-7-bicyclo[4.2.0]octanyl] benzoate (PubChem CID 11970087) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(1S,6S,7S)-7-[(E)-prop-1-enyl]-7-bicyclo[4.2.0]octanyl] benzoate.
| Compound Name | [(1S,6S,7S)-7-[(E)-prop-1-enyl]-7-bicyclo[4.2.0]octanyl] benzoate |
|---|---|
| PubChem CID | 11970087 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [(1S,6S,7S)-7-[(E)-prop-1-enyl]-7-bicyclo[4.2.0]octanyl] benzoate |
| SMILES | C/C=C/[C@@]1(OC(=O)c2ccccc2)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H22O2/c1-2-12-18(13-15-10-6-7-11-16(15)18)20-17(19)14-8-4-3-5-9-14/h2-5,8-9,12,15-16H,6-7,10-11,13H2,1H3/b12-2+/t15-,16-,18+/m0/s1 |
| InChIKey | STSGVNZJFQQJBS-XQZZVBEXSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|