C13H18ClN3O4S — CID 119704304
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 119704304) has the molecular formula C13H18ClN3O4S and a molecular weight of 347.82 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119704304 |
| Molecular Formula | C13H18ClN3O4S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1)C1CC(O)CN1 |
| InChI | InChI=1S/C13H18ClN3O4S/c14-9-2-1-3-11(6-9)22(20,21)17-5-4-15-13(19)12-7-10(18)8-16-12/h1-3,6,10,12,16-18H,4-5,7-8H2,(H,15,19) |
| InChIKey | LOLMVVJEFQVZLX-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|