C14H16ClN5O3S — CID 97339931
trans-(1S,2S)-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxamide (PubChem CID 97339931) has the molecular formula C14H16ClN5O3S and a molecular weight of 369.83 g/mol. Its IUPAC name is trans-(1S,2S)-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97339931 |
| Molecular Formula | C14H16ClN5O3S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | trans-(1S,2S)-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1)[C@H]1C[C@@H]1c1ncn[nH]1 |
| InChI | InChI=1S/C14H16ClN5O3S/c15-9-2-1-3-10(6-9)24(22,23)19-5-4-16-14(21)12-7-11(12)13-17-8-18-20-13/h1-3,6,8,11-12,19H,4-5,7H2,(H,16,21)(H,17,18,20)/t11-,12-/m0/s1 |
| InChIKey | MIIRPNLOWPWOIQ-RYUDHWBXSA-N |
| XLogP | 0.66 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|