C20H25N7O — CID 119710914
5-methyl-N-[2-(2-phenylethyl)pyrazol-3-yl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119710914) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 5-methyl-N-[2-(2-phenylethyl)pyrazol-3-yl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-(2-phenylethyl)pyrazol-3-yl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119710914 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 5-methyl-N-[2-(2-phenylethyl)pyrazol-3-yl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccnn2CCc2ccccc2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C20H25N7O/c1-15-19(24-25-27(15)17-7-11-21-12-8-17)20(28)23-18-9-13-22-26(18)14-10-16-5-3-2-4-6-16/h2-6,9,13,17,21H,7-8,10-12,14H2,1H3,(H,23,28) |
| InChIKey | GQKFGJZRADPRCB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |