C21H29N5O2 — CID 119747043
N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119747043) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119747043 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | COc1ccccc1C1(CNC(=O)c2cn(C3CCNCC3)nn2)CCCC1 |
| InChI | InChI=1S/C21H29N5O2/c1-28-19-7-3-2-6-17(19)21(10-4-5-11-21)15-23-20(27)18-14-26(25-24-18)16-8-12-22-13-9-16/h2-3,6-7,14,16,22H,4-5,8-13,15H2,1H3,(H,23,27) |
| InChIKey | UBUXYUSMHBXAJH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |