C28H21NO2Se — CID 11975361
2-(4-methoxyphenyl)selanyl-3,3-diphenylquinolin-4-one (PubChem CID 11975361) has the molecular formula C28H21NO2Se and a molecular weight of 482.44 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)selanyl-3,3-diphenylquinolin-4-one.
| Compound Name | 2-(4-methoxyphenyl)selanyl-3,3-diphenylquinolin-4-one |
|---|---|
| PubChem CID | 11975361 |
| Molecular Formula | C28H21NO2Se |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2-(4-methoxyphenyl)selanyl-3,3-diphenylquinolin-4-one |
| SMILES | COc1ccc([Se]C2=Nc3ccccc3C(=O)C2(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21NO2Se/c1-31-22-16-18-23(19-17-22)32-27-28(20-10-4-2-5-11-20,21-12-6-3-7-13-21)26(30)24-14-8-9-15-25(24)29-27/h2-19H,1H3 |
| InChIKey | WREPPHWRRCAKKO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|