C15H22Cl2N2O2 — CID 119760143
1-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride (PubChem CID 119760143) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 1-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride.
| Compound Name | 1-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119760143 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride |
| SMILES | COCCNCC(=O)N1CC(C)(C)c2c(Cl)cccc21.Cl |
| InChI | InChI=1S/C15H21ClN2O2.ClH/c1-15(2)10-18(13(19)9-17-7-8-20-3)12-6-4-5-11(16)14(12)15;/h4-6,17H,7-10H2,1-3H3;1H |
| InChIKey | GLAFJPXYXGSCPW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|