C18H12ClN5O3S — CID 11976018
N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-6-nitro-1H-indole-2-carbohydrazide (PubChem CID 11976018) has the molecular formula C18H12ClN5O3S and a molecular weight of 413.85 g/mol. Its IUPAC name is N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-6-nitro-1H-indole-2-carbohydrazide.
| Compound Name | N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-6-nitro-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 11976018 |
| Molecular Formula | C18H12ClN5O3S |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-6-nitro-1H-indole-2-carbohydrazide |
| SMILES | O=C(NNc1nc(-c2ccc(Cl)cc2)cs1)c1cc2ccc([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C18H12ClN5O3S/c19-12-4-1-10(2-5-12)16-9-28-18(21-16)23-22-17(25)15-7-11-3-6-13(24(26)27)8-14(11)20-15/h1-9,20H,(H,21,23)(H,22,25) |
| InChIKey | DYBPJXIYTDUYPB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|