C14H10N4O4S — CID 25096998
N'-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide (PubChem CID 25096998) has the molecular formula C14H10N4O4S and a molecular weight of 330.33 g/mol. Its IUPAC name is N'-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide.
| Compound Name | N'-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 25096998 |
| Molecular Formula | C14H10N4O4S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N'-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1nc(-c2ccc([N+](=O)[O-])cc2)cs1)c1ccco1 |
| InChI | InChI=1S/C14H10N4O4S/c19-13(12-2-1-7-22-12)16-17-14-15-11(8-23-14)9-3-5-10(6-4-9)18(20)21/h1-8H,(H,15,17)(H,16,19) |
| InChIKey | OLLOKMKAUJSLBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|