C20H29Cl2N7O — CID 119832467
5-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride (PubChem CID 119832467) has the molecular formula C20H29Cl2N7O and a molecular weight of 454.41 g/mol. Its IUPAC name is 5-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride.
| Compound Name | 5-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119832467 |
| Molecular Formula | C20H29Cl2N7O |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 5-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
| SMILES | Cc1c(C(=O)NCCCn2c(C)nc3ccccc32)nnn1C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C20H27N7O.2ClH/c1-14-19(24-25-27(14)16-8-11-21-12-9-16)20(28)22-10-5-13-26-15(2)23-17-6-3-4-7-18(17)26;;/h3-4,6-7,16,21H,5,8-13H2,1-2H3,(H,22,28);2*1H |
| InChIKey | YSLAJWWFQDSSHU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|