C50H72O10 — CID 11984539
2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol (PubChem CID 11984539) has the molecular formula C50H72O10 and a molecular weight of 833.12 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 11984539 |
| Molecular Formula | C50H72O10 |
| Molecular Weight | 833.12 g/mol |
| Exact Mass | 832.51 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one;(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1OC.Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C29H50O2.C21H22O8/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29;1-23-13-8-7-11(9-15(13)24-2)14-10-12(22)16-17(25-3)19(26-4)21(28-6)20(27-5)18(16)29-14/h20-22,30H,9-19H2,1-8H3;7-10H,1-6H3/t21-,22-,29-;/m1./s1 |
| InChIKey | KDJVFEUMLQYOMJ-WTCAIEHQSA-N |
| XLogP | 12.35 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.12 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |