C28H29Ir- — CID 11985186
1,3-diphenylbenzene;iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 11985186) has the molecular formula C28H29Ir- and a molecular weight of 557.76 g/mol. Its IUPAC name is 1,3-diphenylbenzene;iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 1,3-diphenylbenzene;iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 11985186 |
| Molecular Formula | C28H29Ir- |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 1,3-diphenylbenzene;iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Ir].c1ccc(-c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C18H14.C10H15.Ir/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;1-6-7(2)9(4)10(5)8(6)3;/h1-14H;1-5H3;/q;-1; |
| InChIKey | SIMOWDGHBXARRF-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|