C22H25Cr- — CID 11986587
1,1'-biphenyl;chromium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 11986587) has the molecular formula C22H25Cr- and a molecular weight of 341.44 g/mol. Its IUPAC name is 1,1'-biphenyl;chromium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 1,1'-biphenyl;chromium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 11986587 |
| Molecular Formula | C22H25Cr- |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1,1'-biphenyl;chromium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Cr].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H15.Cr/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-6-7(2)9(4)10(5)8(6)3;/h1-10H;1-5H3;/q;-1; |
| InChIKey | CSIDRIUXHLWNDK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|