C26H28Hf-2 — CID 154426986
hafnium;1-methyl-2-phenyl-1,3-dihydroinden-3-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 154426986) has the molecular formula C26H28Hf-2 and a molecular weight of 519.00 g/mol. Its IUPAC name is hafnium;1-methyl-2-phenyl-1,3-dihydroinden-3-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | hafnium;1-methyl-2-phenyl-1,3-dihydroinden-3-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154426986 |
| Molecular Formula | C26H28Hf-2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | hafnium;1-methyl-2-phenyl-1,3-dihydroinden-3-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | CC1C(c2ccccc2)=[C-]c2ccccc21.Cc1c(C)c(C)[c-](C)c1C.[Hf] |
| InChI | InChI=1S/C16H13.C10H15.Hf/c1-12-15-10-6-5-9-14(15)11-16(12)13-7-3-2-4-8-13;1-6-7(2)9(4)10(5)8(6)3;/h2-10,12H,1H3;1-5H3;/q2*-1; |
| InChIKey | SJRZAQVASIZCHM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|