C26H27Cl2OTi- — CID 131729290
dichlorotitanium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;1-phenylnaphthalen-2-ol (PubChem CID 131729290) has the molecular formula C26H27Cl2OTi- and a molecular weight of 474.27 g/mol. Its IUPAC name is dichlorotitanium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;1-phenylnaphthalen-2-ol.
| Compound Name | dichlorotitanium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;1-phenylnaphthalen-2-ol |
|---|---|
| PubChem CID | 131729290 |
| Molecular Formula | C26H27Cl2OTi- |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | dichlorotitanium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;1-phenylnaphthalen-2-ol |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.Cl[Ti]Cl.Oc1ccc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C16H12O.C10H15.2ClH.Ti/c17-15-11-10-12-6-4-5-9-14(12)16(15)13-7-2-1-3-8-13;1-6-7(2)9(4)10(5)8(6)3;;;/h1-11,17H;1-5H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | FLOJPRPNUHTUGI-UHFFFAOYSA-L |
| XLogP | 8.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|