C12H16O7 — CID 11988484
dimethyl (2R,3R)-7-hydroxy-1,4-dioxaspiro[4.5]dec-8-ene-2,3-dicarboxylate (PubChem CID 11988484) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is dimethyl (2R,3R)-7-hydroxy-1,4-dioxaspiro[4.5]dec-8-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3R)-7-hydroxy-1,4-dioxaspiro[4.5]dec-8-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11988484 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | dimethyl (2R,3R)-7-hydroxy-1,4-dioxaspiro[4.5]dec-8-ene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1OC2(CC=CC(O)C2)O[C@H]1C(=O)OC |
| InChI | InChI=1S/C12H16O7/c1-16-10(14)8-9(11(15)17-2)19-12(18-8)5-3-4-7(13)6-12/h3-4,7-9,13H,5-6H2,1-2H3/t7?,8-,9-/m1/s1 |
| InChIKey | UUFXKKXOYWWKIQ-CFCGPWAMSA-N |
| XLogP | -0.48 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|