C22H33NO2 — CID 11990922
(3S,6R,8R,10S,11S)-2,2,6,13,13-pentamethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11990922) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S)-2,2,6,13,13-pentamethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,11S)-2,2,6,13,13-pentamethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11990922 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (3S,6R,8R,10S,11S)-2,2,6,13,13-pentamethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@H](c3ccccc3)OC(C)(C)CN1C2(C)C |
| InChI | InChI=1S/C22H33NO2/c1-15-11-12-17-18(13-15)24-20-19(16-9-7-6-8-10-16)25-21(2,3)14-23(20)22(17,4)5/h6-10,15,17-20H,11-14H2,1-5H3/t15-,17-,18-,19+,20+/m1/s1 |
| InChIKey | ZZGBHLNQAQCZPM-XLSIIYIISA-N |
| XLogP | 4.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |