C24H26Cl2N2O5 — CID 11991507
(2R)-2-[(3R)-5,7-dichloro-3-(2-hydroxyethyl)-1-(methoxymethyl)-2-oxoindol-3-yl]-2-(2-methoxyphenyl)pent-4-enamide (PubChem CID 11991507) has the molecular formula C24H26Cl2N2O5 and a molecular weight of 493.39 g/mol. Its IUPAC name is (2R)-2-[(3R)-5,7-dichloro-3-(2-hydroxyethyl)-1-(methoxymethyl)-2-oxoindol-3-yl]-2-(2-methoxyphenyl)pent-4-enamide.
| Compound Name | (2R)-2-[(3R)-5,7-dichloro-3-(2-hydroxyethyl)-1-(methoxymethyl)-2-oxoindol-3-yl]-2-(2-methoxyphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 11991507 |
| Molecular Formula | C24H26Cl2N2O5 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | (2R)-2-[(3R)-5,7-dichloro-3-(2-hydroxyethyl)-1-(methoxymethyl)-2-oxoindol-3-yl]-2-(2-methoxyphenyl)pent-4-enamide |
| SMILES | C=CC[C@@](C(N)=O)(c1ccccc1OC)[C@]1(CCO)C(=O)N(COC)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C24H26Cl2N2O5/c1-4-9-23(21(27)30,16-7-5-6-8-19(16)33-3)24(10-11-29)17-12-15(25)13-18(26)20(17)28(14-32-2)22(24)31/h4-8,12-13,29H,1,9-11,14H2,2-3H3,(H2,27,30)/t23-,24-/m0/s1 |
| InChIKey | KJSDGCDFFROIQM-ZEQRLZLVSA-N |
| XLogP | 3.57 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|